C13H18F3IN6O — CID 109472698
1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472698) has the molecular formula C13H18F3IN6O and a molecular weight of 458.23 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472698 |
| Molecular Formula | C13H18F3IN6O |
| Molecular Weight | 458.23 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccco2)n[nH]1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H17F3N6O.HI/c1-2-17-12(18-6-5-13(14,15)16)19-8-10-20-11(22-21-10)9-4-3-7-23-9;/h3-4,7H,2,5-6,8H2,1H3,(H2,17,18,19)(H,20,21,22);1H |
| InChIKey | YRAOHFKHFVZOLD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|