C18H22ClIN6O — CID 111838928
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111838928) has the molecular formula C18H22ClIN6O and a molecular weight of 500.77 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111838928 |
| Molecular Formula | C18H22ClIN6O |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccco2)n[nH]1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C18H21ClN6O.HI/c1-2-20-18(21-9-8-13-5-3-6-14(19)11-13)22-12-16-23-17(25-24-16)15-7-4-10-26-15;/h3-7,10-11H,2,8-9,12H2,1H3,(H2,20,21,22)(H,23,24,25);1H |
| InChIKey | RLWNJIAPPQLNBR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|