C21H24IN7O2 — CID 111980872
1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111980872) has the molecular formula C21H24IN7O2 and a molecular weight of 533.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111980872 |
| Molecular Formula | C21H24IN7O2 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C21H23N7O2.HI/c1-2-22-21(23-11-10-18-26-19(28-27-18)17-9-6-12-29-17)24-13-16-14-30-20(25-16)15-7-4-3-5-8-15;/h3-9,12,14H,2,10-11,13H2,1H3,(H2,22,23,24)(H,26,27,28);1H |
| InChIKey | VPQMYSWMHCQXRS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|