C20H21N7O2 — CID 111981137
1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111981137) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111981137 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C20H21N7O2/c1-2-21-20(23-12-17-25-18(27-26-17)16-9-6-10-28-16)22-11-15-13-29-19(24-15)14-7-4-3-5-8-14/h3-10,13H,2,11-12H2,1H3,(H2,21,22,23)(H,25,26,27) |
| InChIKey | ZOJCYYRIBVKYOD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|