C24H26IN5O2 — CID 111591776
1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111591776) has the molecular formula C24H26IN5O2 and a molecular weight of 543.41 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591776 |
| Molecular Formula | C24H26IN5O2 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCc1cc(-c2ccccc2)on1.I |
| InChI | InChI=1S/C24H25N5O2.HI/c1-3-25-24(26-14-20-13-22(31-29-20)18-7-5-4-6-8-18)27-15-21-16-30-23(28-21)19-11-9-17(2)10-12-19;/h4-13,16H,3,14-15H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | WUOVNWWFRNSVBT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|