C21H23FN4O — CID 111590163
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine (PubChem CID 111590163) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111590163 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCc1coc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C21H23FN4O/c1-3-23-21(24-12-17-6-4-5-7-19(17)22)25-13-18-14-27-20(26-18)16-10-8-15(2)9-11-16/h4-11,14H,3,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | KQWPCZCJIHVKMB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|