C21H23F2IN4O2 — CID 111553182
2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111553182) has the molecular formula C21H23F2IN4O2 and a molecular weight of 528.34 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553182 |
| Molecular Formula | C21H23F2IN4O2 |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C21H22F2N4O2.HI/c1-2-24-21(25-12-16-10-6-7-11-18(16)29-20(22)23)26-13-17-14-28-19(27-17)15-8-4-3-5-9-15;/h3-11,14,20H,2,12-13H2,1H3,(H2,24,25,26);1H |
| InChIKey | CHFPACCVOWSMRP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|