C15H20F2IN5O2 — CID 111865591
2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111865591) has the molecular formula C15H20F2IN5O2 and a molecular weight of 467.26 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111865591 |
| Molecular Formula | C15H20F2IN5O2 |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCc1nc(C)no1.I |
| InChI | InChI=1S/C15H19F2N5O2.HI/c1-3-18-15(20-9-13-21-10(2)22-24-13)19-8-11-6-4-5-7-12(11)23-14(16)17;/h4-7,14H,3,8-9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | YYXPUUIHCKWWPD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|