C22H24F3IN4O2 — CID 111553744
1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111553744) has the molecular formula C22H24F3IN4O2 and a molecular weight of 560.36 g/mol. Its IUPAC name is 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553744 |
| Molecular Formula | C22H24F3IN4O2 |
| Molecular Weight | 560.36 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OCC(F)(F)F)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C22H23F3N4O2.HI/c1-2-26-21(27-12-17-10-6-7-11-19(17)31-15-22(23,24)25)28-13-18-14-30-20(29-18)16-8-4-3-5-9-16;/h3-11,14H,2,12-13,15H2,1H3,(H2,26,27,28);1H |
| InChIKey | UNKIIZIKIOTVKY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|