C18H24F3IN4O2 — CID 111551997
1-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111551997) has the molecular formula C18H24F3IN4O2 and a molecular weight of 512.31 g/mol. Its IUPAC name is 1-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111551997 |
| Molecular Formula | C18H24F3IN4O2 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C18H23F3N4O2.HI/c1-2-22-17(23-9-6-10-26-13-18(19,20)21)24-11-15-12-27-16(25-15)14-7-4-3-5-8-14;/h3-5,7-8,12H,2,6,9-11,13H2,1H3,(H2,22,23,24);1H |
| InChIKey | WGSOZXUVKPTQIZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|