C22H27N5O — CID 111553807
1-(3-anilinopropyl)-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111553807) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-(3-anilinopropyl)-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111553807 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-(3-anilinopropyl)-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCCNc1ccccc1 |
| InChI | InChI=1S/C22H27N5O/c1-2-23-22(25-15-9-14-24-19-12-7-4-8-13-19)26-16-20-17-28-21(27-20)18-10-5-3-6-11-18/h3-8,10-13,17,24H,2,9,14-16H2,1H3,(H2,23,25,26) |
| InChIKey | YKCSHSQGSZZCRZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|