C15H22F3IN6O — CID 111013778
1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111013778) has the molecular formula C15H22F3IN6O and a molecular weight of 486.28 g/mol. Its IUPAC name is 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013778 |
| Molecular Formula | C15H22F3IN6O |
| Molecular Weight | 486.28 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C15H21F3N6O.HI/c1-2-19-14(20-7-5-9-25-11-15(16,17)18)21-10-13-23-22-12-6-3-4-8-24(12)13;/h3-4,6,8H,2,5,7,9-11H2,1H3,(H2,19,20,21);1H |
| InChIKey | IQZYIAIHWRYUAY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|