C21H26F3IN6O — CID 111856627
1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111856627) has the molecular formula C21H26F3IN6O and a molecular weight of 562.38 g/mol. Its IUPAC name is 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111856627 |
| Molecular Formula | C21H26F3IN6O |
| Molecular Weight | 562.38 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 1-ethyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C21H25F3N6O.HI/c1-2-25-20(26-11-10-19-29-28-18-5-3-4-12-30(18)19)27-13-16-6-8-17(9-7-16)14-31-15-21(22,23)24;/h3-9,12H,2,10-11,13-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | FRCUFIOQVVYELR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|