C20H24F3IN6 — CID 111764744
1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111764744) has the molecular formula C20H24F3IN6 and a molecular weight of 532.35 g/mol. Its IUPAC name is 1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111764744 |
| Molecular Formula | C20H24F3IN6 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C20H23F3N6.HI/c1-2-24-19(26-14-15-7-5-8-16(13-15)20(21,22)23)25-11-6-10-18-28-27-17-9-3-4-12-29(17)18;/h3-5,7-9,12-13H,2,6,10-11,14H2,1H3,(H2,24,25,26);1H |
| InChIKey | UMOSCGYGZCVMJD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|