C21H25F3N6 — CID 111765149
1-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111765149) has the molecular formula C21H25F3N6 and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111765149 |
| Molecular Formula | C21H25F3N6 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2ccccn12)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3N6/c1-2-25-20(27-14-12-16-8-10-17(11-9-16)21(22,23)24)26-13-5-7-19-29-28-18-6-3-4-15-30(18)19/h3-4,6,8-11,15H,2,5,7,12-14H2,1H3,(H2,25,26,27) |
| InChIKey | SMMXCGWFHRZKPY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|