C20H25ClN6 — CID 111766831
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111766831) has the molecular formula C20H25ClN6 and a molecular weight of 384.92 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111766831 |
| Molecular Formula | C20H25ClN6 |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2ccccn12)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H25ClN6/c1-2-22-20(24-13-11-16-7-5-8-17(21)15-16)23-12-6-10-19-26-25-18-9-3-4-14-27(18)19/h3-5,7-9,14-15H,2,6,10-13H2,1H3,(H2,22,23,24) |
| InChIKey | JPOPPDSCAVPQKP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|