C18H22ClIN6 — CID 111015674
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015674) has the molecular formula C18H22ClIN6 and a molecular weight of 484.77 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015674 |
| Molecular Formula | C18H22ClIN6 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C18H21ClN6.HI/c1-2-20-18(21-10-9-14-6-5-7-15(19)12-14)22-13-17-24-23-16-8-3-4-11-25(16)17;/h3-8,11-12H,2,9-10,13H2,1H3,(H2,20,21,22);1H |
| InChIKey | VGRONFHPCLPFBD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|