C20H23ClIN7 — CID 111780182
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111780182) has the molecular formula C20H23ClIN7 and a molecular weight of 523.81 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111780182 |
| Molecular Formula | C20H23ClIN7 |
| Molecular Weight | 523.81 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1c[nH]c2ccc(Cl)cc12.I |
| InChI | InChI=1S/C20H22ClN7.HI/c1-2-22-20(25-13-19-27-26-18-5-3-4-10-28(18)19)23-9-8-14-12-24-17-7-6-15(21)11-16(14)17;/h3-7,10-12,24H,2,8-9,13H2,1H3,(H2,22,23,25);1H |
| InChIKey | NPWDJSBLZKBXLH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|