C19H21F3N6 — CID 111764697
2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111764697) has the molecular formula C19H21F3N6 and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111764697 |
| Molecular Formula | C19H21F3N6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N6/c1-23-18(25-13-14-6-4-7-15(12-14)19(20,21)22)24-10-5-9-17-27-26-16-8-2-3-11-28(16)17/h2-4,6-8,11-12H,5,9-10,13H2,1H3,(H2,23,24,25) |
| InChIKey | NNQLMUAXFFZERI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|