C24H33N7 — CID 111769039
2-methyl-1-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111769039) has the molecular formula C24H33N7 and a molecular weight of 419.58 g/mol. Its IUPAC name is 2-methyl-1-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111769039 |
| Molecular Formula | C24H33N7 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 2-methyl-1-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H33N7/c1-25-24(26-14-7-9-23-29-28-22-8-3-6-17-31(22)23)27-18-20-10-12-21(13-11-20)19-30-15-4-2-5-16-30/h3,6,8,10-13,17H,2,4-5,7,9,14-16,18-19H2,1H3,(H2,25,26,27) |
| InChIKey | IKIVBXMGPFUDEB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|