C21H29IN6O3 — CID 111767438
2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111767438) has the molecular formula C21H29IN6O3 and a molecular weight of 540.41 g/mol. Its IUPAC name is 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111767438 |
| Molecular Formula | C21H29IN6O3 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-methyl-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C21H28N6O3.HI/c1-22-21(23-10-7-9-19-26-25-18-8-5-6-11-27(18)19)24-14-15-12-16(28-2)20(30-4)17(13-15)29-3;/h5-6,8,11-13H,7,9-10,14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | LACFEZVHEKAZCN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|