C18H21ClN6O — CID 111835919
1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine (PubChem CID 111835919) has the molecular formula C18H21ClN6O and a molecular weight of 372.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111835919 |
| Molecular Formula | C18H21ClN6O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(-c2ccco2)n[nH]1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN6O/c1-2-20-18(21-10-9-13-5-7-14(19)8-6-13)22-12-16-23-17(25-24-16)15-4-3-11-26-15/h3-8,11H,2,9-10,12H2,1H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | VZQZULOEZZODFB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|