C21H26IN7O2 — CID 111840422
1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111840422) has the molecular formula C21H26IN7O2 and a molecular weight of 535.39 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111840422 |
| Molecular Formula | C21H26IN7O2 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C21H25N7O2.HI/c1-2-22-21(24-14-18-25-20(27-26-18)17-5-4-12-30-17)23-13-15-7-9-16(10-8-15)28-11-3-6-19(28)29;/h4-5,7-10,12H,2-3,6,11,13-14H2,1H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | KFBBKQDWFPMSHR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|