C22H29IN6O2 — CID 111170964
1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111170964) has the molecular formula C22H29IN6O2 and a molecular weight of 536.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111170964 |
| Molecular Formula | C22H29IN6O2 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-ethyl-3-[2-(4-methoxyphenyl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(OC)cc2)n[nH]1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C22H28N6O2.HI/c1-4-23-22(24-14-13-16-5-9-18(29-2)10-6-16)25-15-20-26-21(28-27-20)17-7-11-19(30-3)12-8-17;/h5-12H,4,13-15H2,1-3H3,(H2,23,24,25)(H,26,27,28);1H |
| InChIKey | AVHAYFWCKVNTLW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|