C22H35N7O — CID 111371639
1-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111371639) has the molecular formula C22H35N7O and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111371639 |
| Molecular Formula | C22H35N7O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 1-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(OC)cc2)n[nH]1)NCCCN1CCCCC1C |
| InChI | InChI=1S/C22H35N7O/c1-4-23-22(24-13-7-15-29-14-6-5-8-17(29)2)25-16-20-26-21(28-27-20)18-9-11-19(30-3)12-10-18/h9-12,17H,4-8,13-16H2,1-3H3,(H2,23,24,25)(H,26,27,28) |
| InChIKey | PFFDXEWDONHRMB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|