C20H28IN7OS — CID 111531794
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111531794) has the molecular formula C20H28IN7OS and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531794 |
| Molecular Formula | C20H28IN7OS |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(OC)cc2)n[nH]1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C20H27N7OS.HI/c1-4-16-12-23-18(29-16)10-11-22-20(21-5-2)24-13-17-25-19(27-26-17)14-6-8-15(28-3)9-7-14;/h6-9,12H,4-5,10-11,13H2,1-3H3,(H2,21,22,24)(H,25,26,27);1H |
| InChIKey | LILUNFFGIYCOIW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|