C18H28ClN5OS — CID 109404545
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethylguanidine (PubChem CID 109404545) has the molecular formula C18H28ClN5OS and a molecular weight of 397.98 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109404545 |
| Molecular Formula | C18H28ClN5OS |
| Molecular Weight | 397.98 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H28ClN5OS/c1-5-13-12(14(6-2)24(4)23-13)10-21-18(20-7-3)22-11-15(25)16-8-9-17(19)26-16/h8-9,15,25H,5-7,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | MXMIWCDRSAWCNZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.98 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|