C18H23ClF2IN3O3S — CID 111702285
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111702285) has the molecular formula C18H23ClF2IN3O3S and a molecular weight of 561.82 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111702285 |
| Molecular Formula | C18H23ClF2IN3O3S |
| Molecular Weight | 561.82 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C18H22ClF2N3O3S.HI/c1-3-22-18(24-10-12(25)15-6-7-16(19)28-15)23-9-11-4-5-13(26-2)14(8-11)27-17(20)21;/h4-8,12,17,25H,3,9-10H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | AUIWRUIXOPAUSP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|