C18H25ClIN3OS — CID 111502072
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111502072) has the molecular formula C18H25ClIN3OS and a molecular weight of 493.84 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111502072 |
| Molecular Formula | C18H25ClIN3OS |
| Molecular Weight | 493.84 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCCc1ccccc1.I |
| InChI | InChI=1S/C18H24ClN3OS.HI/c1-2-20-18(21-12-6-9-14-7-4-3-5-8-14)22-13-15(23)16-10-11-17(19)24-16;/h3-5,7-8,10-11,15,23H,2,6,9,12-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | BDSUCWDFCSOFPF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|