C16H30ClIN4OS — CID 111702643
1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111702643) has the molecular formula C16H30ClIN4OS and a molecular weight of 488.87 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111702643 |
| Molecular Formula | C16H30ClIN4OS |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCN(C)C(C)CC.I |
| InChI | InChI=1S/C16H29ClN4OS.HI/c1-5-12(3)21(4)10-9-19-16(18-6-2)20-11-13(22)14-7-8-15(17)23-14;/h7-8,12-13,22H,5-6,9-11H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | RYERGVQAACVVAQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|