C13H21ClIN3OS — CID 119153667
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-cyclobutyl-3-ethylguanidine;hydroiodide (PubChem CID 119153667) has the molecular formula C13H21ClIN3OS and a molecular weight of 429.76 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-cyclobutyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-cyclobutyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153667 |
| Molecular Formula | C13H21ClIN3OS |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-cyclobutyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NC1CCC1.I |
| InChI | InChI=1S/C13H20ClN3OS.HI/c1-2-15-13(17-9-4-3-5-9)16-8-10(18)11-6-7-12(14)19-11;/h6-7,9-10,18H,2-5,8H2,1H3,(H2,15,16,17);1H |
| InChIKey | VJJRMAHWCPFMBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|