C14H24ClN3OS — CID 111494994
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-methylbutyl)guanidine (PubChem CID 111494994) has the molecular formula C14H24ClN3OS and a molecular weight of 317.89 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-methylbutyl)guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 111494994 |
| Molecular Formula | C14H24ClN3OS |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(3-methylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCC(C)C |
| InChI | InChI=1S/C14H24ClN3OS/c1-4-16-14(17-8-7-10(2)3)18-9-11(19)12-5-6-13(15)20-12/h5-6,10-11,19H,4,7-9H2,1-3H3,(H2,16,17,18) |
| InChIKey | YMWKIUBXRCEORT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|