C18H31ClN4O3S — CID 111702300
ethyl N-[1-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 111702300) has the molecular formula C18H31ClN4O3S and a molecular weight of 418.99 g/mol. Its IUPAC name is ethyl N-[1-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111702300 |
| Molecular Formula | C18H31ClN4O3S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | ethyl N-[1-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCC(CC(C)C)NC(=O)OCC |
| InChI | InChI=1S/C18H31ClN4O3S/c1-5-20-17(22-11-14(24)15-7-8-16(19)27-15)21-10-13(9-12(3)4)23-18(25)26-6-2/h7-8,12-14,24H,5-6,9-11H2,1-4H3,(H,23,25)(H2,20,21,22) |
| InChIKey | MPRMWAOQIRJSFM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|