C18H30ClN3O3S — CID 111701787
ethyl 7-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]heptanoate (PubChem CID 111701787) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is ethyl 7-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111701787 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | ethyl 7-[[N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]heptanoate |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCCCCCC(=O)OCC |
| InChI | InChI=1S/C18H30ClN3O3S/c1-3-20-18(22-13-14(23)15-10-11-16(19)26-15)21-12-8-6-5-7-9-17(24)25-4-2/h10-11,14,23H,3-9,12-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | GTCPTZIZZYPQFE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|