C19H40IN3O3 — CID 111709892
ethyl 7-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111709892) has the molecular formula C19H40IN3O3 and a molecular weight of 485.45 g/mol. Its IUPAC name is ethyl 7-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111709892 |
| Molecular Formula | C19H40IN3O3 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | ethyl 7-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)NCCCCCCC(=O)OCC.I |
| InChI | InChI=1S/C19H39N3O3.HI/c1-7-20-18(22-15-16(24-6)19(3,4)5)21-14-12-10-9-11-13-17(23)25-8-2;/h16H,7-15H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | JDJOEXHBNNNZII-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|