C14H29N3O3 — CID 111607873
ethyl 4-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]butanoate (PubChem CID 111607873) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111607873 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]butanoate |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCCCC(=O)OCC |
| InChI | InChI=1S/C14H29N3O3/c1-6-15-13(17-11-14(3,4)19-5)16-10-8-9-12(18)20-7-2/h6-11H2,1-5H3,(H2,15,16,17) |
| InChIKey | YGSBOKPJSLZEHJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|