C19H35N5O3 — CID 111655692
ethyl 7-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]heptanoate (PubChem CID 111655692) has the molecular formula C19H35N5O3 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethyl 7-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111655692 |
| Molecular Formula | C19H35N5O3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | ethyl 7-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]heptanoate |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCCCCCC(=O)OCC |
| InChI | InChI=1S/C19H35N5O3/c1-5-20-18(21-12-10-8-7-9-11-17(25)27-6-2)22-15-19(3,26)16-13-23-24(4)14-16/h13-14,26H,5-12,15H2,1-4H3,(H2,20,21,22) |
| InChIKey | DBJFDYIYGZBVIL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|