C18H29IN6O2S — CID 111655775
N-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111655775) has the molecular formula C18H29IN6O2S and a molecular weight of 520.44 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111655775 |
| Molecular Formula | C18H29IN6O2S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCCNC(=O)c1cccs1.I |
| InChI | InChI=1S/C18H28N6O2S.HI/c1-4-19-17(22-13-18(2,26)14-11-23-24(3)12-14)21-9-6-8-20-16(25)15-7-5-10-27-15;/h5,7,10-12,26H,4,6,8-9,13H2,1-3H3,(H,20,25)(H2,19,21,22);1H |
| InChIKey | VOBXIAGWPXIEGO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|