C14H31IN4O2 — CID 111709932
N-[2-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111709932) has the molecular formula C14H31IN4O2 and a molecular weight of 414.33 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111709932 |
| Molecular Formula | C14H31IN4O2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-methoxy-3,3-dimethylbutyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)NCCNC(C)=O.I |
| InChI | InChI=1S/C14H30N4O2.HI/c1-7-15-13(17-9-8-16-11(2)19)18-10-12(20-6)14(3,4)5;/h12H,7-10H2,1-6H3,(H,16,19)(H2,15,17,18);1H |
| InChIKey | XEMYSGJJFFBRKU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|