C20H42IN3O3 — CID 111714663
ethyl 7-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111714663) has the molecular formula C20H42IN3O3 and a molecular weight of 499.48 g/mol. Its IUPAC name is ethyl 7-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111714663 |
| Molecular Formula | C20H42IN3O3 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | ethyl 7-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCCCCCC(=O)OCC.I |
| InChI | InChI=1S/C20H41N3O3.HI/c1-5-21-20(23-16-18(12-14-24)15-17(3)4)22-13-10-8-7-9-11-19(25)26-6-2;/h17-18,24H,5-16H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | JZXDAMGUYKFSDN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|