C18H35N5O3 — CID 111928394
ethyl N-[1-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 111928394) has the molecular formula C18H35N5O3 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl N-[1-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111928394 |
| Molecular Formula | C18H35N5O3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | ethyl N-[1-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C18H35N5O3/c1-5-19-17(21-10-9-20-16(24)14-7-8-14)22-12-15(11-13(3)4)23-18(25)26-6-2/h13-15H,5-12H2,1-4H3,(H,20,24)(H,23,25)(H2,19,21,22) |
| InChIKey | CAKMHOOVJPVWKQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|