C10H22N4O2 — CID 110927322
ethyl N-[1-(diaminomethylideneamino)-4-methylpentan-2-yl]carbamate (PubChem CID 110927322) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is ethyl N-[1-(diaminomethylideneamino)-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-(diaminomethylideneamino)-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 110927322 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | ethyl N-[1-(diaminomethylideneamino)-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CN=C(N)N)CC(C)C |
| InChI | InChI=1S/C10H22N4O2/c1-4-16-10(15)14-8(5-7(2)3)6-13-9(11)12/h7-8H,4-6H2,1-3H3,(H,14,15)(H4,11,12,13) |
| InChIKey | BQHYMIFGQIBKRB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|