C16H34N4O3 — CID 111237963
ethyl N-[1-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 111237963) has the molecular formula C16H34N4O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111237963 |
| Molecular Formula | C16H34N4O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | ethyl N-[1-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NC(C)COC |
| InChI | InChI=1S/C16H34N4O3/c1-7-17-15(19-13(5)11-22-6)18-10-14(9-12(3)4)20-16(21)23-8-2/h12-14H,7-11H2,1-6H3,(H,20,21)(H2,17,18,19) |
| InChIKey | MTNGIOBURXJGRC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|