C16H33IN4O2 — CID 111963608
ethyl N-[1-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 111963608) has the molecular formula C16H33IN4O2 and a molecular weight of 440.37 g/mol. Its IUPAC name is ethyl N-[1-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111963608 |
| Molecular Formula | C16H33IN4O2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | ethyl N-[1-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC(CC(C)C)NC(=O)OCC)NC1CC1C.I |
| InChI | InChI=1S/C16H32N4O2.HI/c1-6-17-15(20-14-9-12(14)5)18-10-13(8-11(3)4)19-16(21)22-7-2;/h11-14H,6-10H2,1-5H3,(H,19,21)(H2,17,18,20);1H |
| InChIKey | IZNDXSXHXPZCJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|