C15H31IN4O2 — CID 111962336
ethyl N-[4-methyl-1-[[N'-methyl-N-(2-methylcyclopropyl)carbamimidoyl]amino]pentan-2-yl]carbamate;hydroiodide (PubChem CID 111962336) has the molecular formula C15H31IN4O2 and a molecular weight of 426.34 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[N'-methyl-N-(2-methylcyclopropyl)carbamimidoyl]amino]pentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[4-methyl-1-[[N'-methyl-N-(2-methylcyclopropyl)carbamimidoyl]amino]pentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111962336 |
| Molecular Formula | C15H31IN4O2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl N-[4-methyl-1-[[N'-methyl-N-(2-methylcyclopropyl)carbamimidoyl]amino]pentan-2-yl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N\C)NC1CC1C)CC(C)C.I |
| InChI | InChI=1S/C15H30N4O2.HI/c1-6-21-15(20)18-12(7-10(2)3)9-17-14(16-5)19-13-8-11(13)4;/h10-13H,6-9H2,1-5H3,(H,18,20)(H2,16,17,19);1H |
| InChIKey | XDIMFLJOBWCTTB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|