C19H32N4O2 — CID 111360673
ethyl N-[4-methyl-1-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]pentan-2-yl]carbamate (PubChem CID 111360673) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111360673 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | ethyl N-[4-methyl-1-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N\C)NCc1ccccc1C)CC(C)C |
| InChI | InChI=1S/C19H32N4O2/c1-6-25-19(24)23-17(11-14(2)3)13-22-18(20-5)21-12-16-10-8-7-9-15(16)4/h7-10,14,17H,6,11-13H2,1-5H3,(H,23,24)(H2,20,21,22) |
| InChIKey | WKMDUFGDFKXSRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|