C16H34N4O2 — CID 111128443
ethyl N-[4-methyl-1-[(N'-methyl-N-pentylcarbamimidoyl)amino]pentan-2-yl]carbamate (PubChem CID 111128443) has the molecular formula C16H34N4O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[(N'-methyl-N-pentylcarbamimidoyl)amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[(N'-methyl-N-pentylcarbamimidoyl)amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111128443 |
| Molecular Formula | C16H34N4O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | ethyl N-[4-methyl-1-[(N'-methyl-N-pentylcarbamimidoyl)amino]pentan-2-yl]carbamate |
| SMILES | CCCCCN/C(=N\C)NCC(CC(C)C)NC(=O)OCC |
| InChI | InChI=1S/C16H34N4O2/c1-6-8-9-10-18-15(17-5)19-12-14(11-13(3)4)20-16(21)22-7-2/h13-14H,6-12H2,1-5H3,(H,20,21)(H2,17,18,19) |
| InChIKey | LQOJLCKOQLFYPA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|