C15H32N4O2 — CID 110945688
ethyl N-[1-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]-4-methylpentan-2-yl]carbamate (PubChem CID 110945688) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is ethyl N-[1-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 110945688 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | ethyl N-[1-[(N-butan-2-yl-N'-methylcarbamimidoyl)amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N/C)NC(C)CC)CC(C)C |
| InChI | InChI=1S/C15H32N4O2/c1-7-12(5)18-14(16-6)17-10-13(9-11(3)4)19-15(20)21-8-2/h11-13H,7-10H2,1-6H3,(H,19,20)(H2,16,17,18) |
| InChIKey | YTABXOOARMWWPO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|