C18H35F3IN5O2 — CID 109377550
ethyl N-[4-methyl-1-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate;hydroiodide (PubChem CID 109377550) has the molecular formula C18H35F3IN5O2 and a molecular weight of 537.41 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[4-methyl-1-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109377550 |
| Molecular Formula | C18H35F3IN5O2 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | ethyl N-[4-methyl-1-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1)CC(C)C.I |
| InChI | InChI=1S/C18H34F3N5O2.HI/c1-6-28-17(27)24-15(11-13(2)3)12-23-16(22-5)26-9-7-25(8-10-26)14(4)18(19,20)21;/h13-15H,6-12H2,1-5H3,(H,22,23)(H,24,27);1H |
| InChIKey | OGOQNWAMGMJIJP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|