C20H37N5O4 — CID 111301719
ethyl N-[4-methyl-1-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate (PubChem CID 111301719) has the molecular formula C20H37N5O4 and a molecular weight of 411.55 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 111301719 |
| Molecular Formula | C20H37N5O4 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | ethyl N-[4-methyl-1-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N\C)N1CCN(C(=O)C2CCCO2)CC1)CC(C)C |
| InChI | InChI=1S/C20H37N5O4/c1-5-28-20(27)23-16(13-15(2)3)14-22-19(21-4)25-10-8-24(9-11-25)18(26)17-7-6-12-29-17/h15-17H,5-14H2,1-4H3,(H,21,22)(H,23,27) |
| InChIKey | BUQHPLPXWQYVRX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|